|
|
3-Chloro-1-propanol
2023/12/22 20:51:00 |
| 3-Chloro-1-propanol
Name: 3-Chloro-1-propanol
Synonyms: 1-Chloro-3-hydroxypropane; Trim ethylene chlorohydrins
CAS NO: 627-30-5
EINECS: 210-992-9
Structural formula : CLCH2CH2CH2OH
Molecular Structure:
Property: Colorless transparent liqu... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
6-Chloro-1-hexanol
2023/12/22 20:51:00 |
| 6-Chloro-1-hexanol
Name: 6-Chlorohexanol
Synonyms:1-Chloro-6-hydroxyhexane;6-Chloro-1-hexanol;Hexamethylene chlorohydrin
CAS NO: 2009-83-8
EINECS: 217-925-2
Structural formula: C8H13CLO
Molecular Structure:
Physical property: Colorless ... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Allyl heptanoate
2023/12/22 20:51:00 |
| Allyl heptanoate
Name: Allyl heptanoate
Molecular Structure:
Molecular Formula: C10H18O2
Molecular Weight: 170.25
CAS NO: 142-19-8
EINECS: 205-527-1
Appearance: colorless transparent liquid with scent of pineapple
Purity: 99%min
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
Allyl hexanoate
2023/12/22 20:51:00 |
| Allyl hexanoate
Name: Allyl hexanoate
Synonyms: 2-Propenyl n-hexanoate,allyl caproate
CAS-NO.: 123-68-2
EINECS: 204-642-4
Molecular Formula: C9H16O2
Structural Formula:CH3(CH2)COOCH2CH=CH2
Molecular Weight: 156.22
Molecular Structure:
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Allyl phenoxyacetate
2023/12/22 20:51:00 |
| Allyl phenoxyacetate
Name: Allyl phenoxyacetate
Synonyms: 2-Propenylphenoxyacetate
Molecular Structure:
Molecular Formula: C11H12O3
Molecular Weight: 192.21
CAS NO: 7493-74-5
EINECS: 231-335-2
Density: 1.102
Boiling point: ... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
Allyl acetate
2023/12/22 20:51:00 |
| Allyl acetate
Name: Allyl acetate
Synonyms: 3-Acetoxypropene; 2-Propenyl ethanoate
Molecular Formula: C5H8O2
Molecular Weight: 100.12
CAS NO: 591-87-7
EINECS: 209-734-8
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Allyl alcohol
2023/12/22 20:51:00 |
| Allyl alcohol
Name: Allyl alcohol
Synonyms: 1-Propen-3-ol; 2-Propen-1-ol; 3-Hydroxypropene
CAS NO: 107-18-6
EINECS: 203-470-7
Chemical Formula: CH2=CHCH2OH
Molecular Formula: C3H6O
Molecular Weight: 58.08
Molecular Structure:
Physical ... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
Dichlormid
2023/12/22 20:51:00 |
| Dichlormid
Name: Dichlormid
Synonyms: EPTC antidote; R-25788; Antidote dichlormid; Dichlormid safener eradicane; N,N-Diallyl-2,2-dichloroacetamide
CAS NO:37764-25-3
EINECS: 253-658-8
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
N-Methylallylamine
2023/12/22 20:51:00 |
| N-Methylallylamine
Name: N-Methylallylamine
Synonyms: N-Methylallylamine ,2-Propen-1-amine,N-methyl-;allylmethylamine;methylallylamine;N-Allyl-N-methylamine;n-methyl-2-propen-1-amin;n-methyl-2-propen-1-amine;n-methyl-allylamin;N-ALLYLMETHYLAMINE
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
Diallyldimethylammonium chloride
2023/12/22 20:51:00 |
| Diallyldimethylammonium chloride
Name: Diallyldimethylammonium chloride
Synonyms:Diallyldimethylammoniumchloride;N,N-Dimethyl-N-2-propenyl-2-propen-1-aminium chloride; Diallyl dimethyl ammonium chloride
Molecular Structure:
Molecular ... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Methyldiallylamine
2023/12/22 20:51:00 |
| Methyldiallylamine
Name: Methyldiallylamine
Synonyms : Diallylmethylamine
Molecular Formula: C7H13N
Molecular Weight: 111.19
CAS NO: 2424-01-3
EINECS: 219-354-4
... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
N,N-Dimethylallylamine
2023/12/22 20:51:00 |
| N,N-Dimethylallylamine
CAS NO: 2155-94-4
EINECS: 218-458-7
Chemical Name: N,N-Dimethylallylamine
Synonyms:CH2=CHCH2N(CH3)2;Dimethylallylamine;ALLYLDIMETHYLAMINE;N-ALLYDIMETHYLAMINE;N-ALLYLDIMETHYLAMINE;N-Allyl-dimethylamin;N,N-DIMETHYLALLYAMI... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Triallylamine
2023/12/22 20:51:00 |
| Triallylamine
Name: Triallylamine
Synonyms: N,N-Di-2-propenyl-2-propen-1-amine; Tri-2-propenylamine
CAS NO: 102-70-5
EINECS: 203-048-2
Molecular Formula: C9H15N
Structural Formula:
Physical property: transparent and colorless to yello... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
Diallylamine
2023/12/22 20:51:00 |
| Diallylamine
Name: Diallylamine
Synonyms: Di-2-propenylamine; N-2-Propenyl-2-propen-1-amine
CAS NO: 124-02-7
EINECS: 204-671-2
Chemical Formula: NH (CH2-CH=CH2)2
Molecular Formula: C6H11N
Molecular Structure:
Molecular Weight: 97.16
Phy... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
| |
|
|
Allylamine
2023/12/22 20:51:00 |
| Allylamine
Synonyms: 2-Propen-1-amine; 2-Propenamine; 3-Amino-1-propene;3-Aminopropene
CAS NO: 107-11-9
EINECS: 203-463-9
Molecular Formula: C3H7N
Molecular Weight: 57.09
Structural Formula:
Properties: Colorless transparent liquid. Meltin... |
| [China] Zouping Mingxing Chemical Co.,Ltd.(China) |
|
|
|
